C13H18N4S — CID 114057597
1-[2-(1-methylimidazol-2-yl)sulfanyl-3-pyridinyl]butan-2-amine (PubChem CID 114057597) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)sulfanyl-3-pyridinyl]butan-2-amine.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)sulfanyl-3-pyridinyl]butan-2-amine |
|---|---|
| PubChem CID | 114057597 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)sulfanyl-3-pyridinyl]butan-2-amine |
| SMILES | CCC(N)Cc1cccnc1Sc1nccn1C |
| InChI | InChI=1S/C13H18N4S/c1-3-11(14)9-10-5-4-6-15-12(10)18-13-16-7-8-17(13)2/h4-8,11H,3,9,14H2,1-2H3 |
| InChIKey | NUUBKSXWWREEIX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |