C18H31NS — CID 107763957
N-[1-(3,4-dimethylphenyl)-2-(3-methylbutylsulfanyl)ethyl]propan-1-amine (PubChem CID 107763957) has the molecular formula C18H31NS and a molecular weight of 293.52 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-2-(3-methylbutylsulfanyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3,4-dimethylphenyl)-2-(3-methylbutylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107763957 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-2-(3-methylbutylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSCCC(C)C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H31NS/c1-6-10-19-18(13-20-11-9-14(2)3)17-8-7-15(4)16(5)12-17/h7-8,12,14,18-19H,6,9-11,13H2,1-5H3 |
| InChIKey | OWVCZLBHALUNOX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|