C16H27NO2S2 — CID 64610659
N-[1-(3,4-dimethylphenyl)-2-(2-methylsulfonylethylsulfanyl)ethyl]propan-1-amine (PubChem CID 64610659) has the molecular formula C16H27NO2S2 and a molecular weight of 329.53 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-2-(2-methylsulfonylethylsulfanyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3,4-dimethylphenyl)-2-(2-methylsulfonylethylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64610659 |
| Molecular Formula | C16H27NO2S2 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-2-(2-methylsulfonylethylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSCCS(C)(=O)=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H27NO2S2/c1-5-8-17-16(12-20-9-10-21(4,18)19)15-7-6-13(2)14(3)11-15/h6-7,11,16-17H,5,8-10,12H2,1-4H3 |
| InChIKey | SAILJROURGYACM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|