C14H24O3 — CID 10776444
[(4S,5S)-5-[(1Z,4Z)-deca-1,4-dienyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 10776444) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is [(4S,5S)-5-[(1Z,4Z)-deca-1,4-dienyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-[(1Z,4Z)-deca-1,4-dienyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10776444 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | [(4S,5S)-5-[(1Z,4Z)-deca-1,4-dienyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCC/C=C\C/C=C\[C@@H]1OCO[C@H]1CO |
| InChI | InChI=1S/C14H24O3/c1-2-3-4-5-6-7-8-9-10-13-14(11-15)17-12-16-13/h6-7,9-10,13-15H,2-5,8,11-12H2,1H3/b7-6-,10-9-/t13-,14-/m0/s1 |
| InChIKey | QYOZHGJFERSPMI-NVHZEWLOSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|