C14H29NOS — CID 107764801
2-cyclopropyl-3-(2-methylbutylsulfanyl)-2-(propan-2-ylamino)propan-1-ol (PubChem CID 107764801) has the molecular formula C14H29NOS and a molecular weight of 259.46 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2-methylbutylsulfanyl)-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-(2-methylbutylsulfanyl)-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 107764801 |
| Molecular Formula | C14H29NOS |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-cyclopropyl-3-(2-methylbutylsulfanyl)-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CCC(C)CSCC(CO)(NC(C)C)C1CC1 |
| InChI | InChI=1S/C14H29NOS/c1-5-12(4)8-17-10-14(9-16,13-6-7-13)15-11(2)3/h11-13,15-16H,5-10H2,1-4H3 |
| InChIKey | SIDOZSZGIUUGHK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |