C10H14FN3OS — CID 107765044
5-fluoro-N-methyl-4-(2-methyloxolan-3-yl)sulfanylpyrimidin-2-amine (PubChem CID 107765044) has the molecular formula C10H14FN3OS and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-fluoro-N-methyl-4-(2-methyloxolan-3-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-methyl-4-(2-methyloxolan-3-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 107765044 |
| Molecular Formula | C10H14FN3OS |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 5-fluoro-N-methyl-4-(2-methyloxolan-3-yl)sulfanylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(SC2CCOC2C)n1 |
| InChI | InChI=1S/C10H14FN3OS/c1-6-8(3-4-15-6)16-9-7(11)5-13-10(12-2)14-9/h5-6,8H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | XZKACMYXAPXCKC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |