C15H27N3OS — CID 107765335
2-(ethoxymethyl)-6-pentylsulfanyl-N-propylpyrimidin-4-amine (PubChem CID 107765335) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 2-(ethoxymethyl)-6-pentylsulfanyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(ethoxymethyl)-6-pentylsulfanyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107765335 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-(ethoxymethyl)-6-pentylsulfanyl-N-propylpyrimidin-4-amine |
| SMILES | CCCCCSc1cc(NCCC)nc(COCC)n1 |
| InChI | InChI=1S/C15H27N3OS/c1-4-7-8-10-20-15-11-13(16-9-5-2)17-14(18-15)12-19-6-3/h11H,4-10,12H2,1-3H3,(H,16,17,18) |
| InChIKey | NWJLWUBXCGDRTE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|