C12H15N5O — CID 10776762
(11R,15S)-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 10776762) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is (11R,15S)-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 10776762 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (11R,15S)-4,8-dimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | Cc1nc2c([nH]1)C(=O)N(C)C1=N[C@@H]3CCC[C@@H]3N12 |
| InChI | InChI=1S/C12H15N5O/c1-6-13-9-10(14-6)17-8-5-3-4-7(8)15-12(17)16(2)11(9)18/h7-8H,3-5H2,1-2H3,(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | ARPIRHYHUOOCNG-SFYZADRCSA-N |
| XLogP | 0.90 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |