C11H15NO3S — CID 107770120
6-(3-hydroxybutan-2-ylsulfanylmethyl)pyridine-2-carboxylic acid (PubChem CID 107770120) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 6-(3-hydroxybutan-2-ylsulfanylmethyl)pyridine-2-carboxylic acid.
| Compound Name | 6-(3-hydroxybutan-2-ylsulfanylmethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 107770120 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 6-(3-hydroxybutan-2-ylsulfanylmethyl)pyridine-2-carboxylic acid |
| SMILES | CC(O)C(C)SCc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C11H15NO3S/c1-7(13)8(2)16-6-9-4-3-5-10(12-9)11(14)15/h3-5,7-8,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | QZXMYPCJWCLLEP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |