C11H24N2O2S — CID 107771849
4-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)pentanamide (PubChem CID 107771849) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)pentanamide.
| Compound Name | 4-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 107771849 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)pentanamide |
| SMILES | CNC(C)(CC(C)SC(C)C(C)O)C(N)=O |
| InChI | InChI=1S/C11H24N2O2S/c1-7(16-9(3)8(2)14)6-11(4,13-5)10(12)15/h7-9,13-14H,6H2,1-5H3,(H2,12,15) |
| InChIKey | KPJNGMBHVFIIQF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |