C15H24FNOS — CID 107772146
3-[2-[(tert-butylamino)methyl]-4-fluorophenyl]sulfanylbutan-2-ol (PubChem CID 107772146) has the molecular formula C15H24FNOS and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-[2-[(tert-butylamino)methyl]-4-fluorophenyl]sulfanylbutan-2-ol.
| Compound Name | 3-[2-[(tert-butylamino)methyl]-4-fluorophenyl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772146 |
| Molecular Formula | C15H24FNOS |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-[2-[(tert-butylamino)methyl]-4-fluorophenyl]sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)Sc1ccc(F)cc1CNC(C)(C)C |
| InChI | InChI=1S/C15H24FNOS/c1-10(18)11(2)19-14-7-6-13(16)8-12(14)9-17-15(3,4)5/h6-8,10-11,17-18H,9H2,1-5H3 |
| InChIKey | ZFOBNDZRBCEWPH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |