C14H22FNO2S2 — CID 63805350
N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 63805350) has the molecular formula C14H22FNO2S2 and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63805350 |
| Molecular Formula | C14H22FNO2S2 |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cc(F)ccc1SCCS(C)(=O)=O |
| InChI | InChI=1S/C14H22FNO2S2/c1-14(2,3)16-10-11-9-12(15)5-6-13(11)19-7-8-20(4,17)18/h5-6,9,16H,7-8,10H2,1-4H3 |
| InChIKey | XRVGPZYZHCJLRB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |