About 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol
3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol (PubChem CID 107772699) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol.
Molecular Properties
| Compound Name | 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol |
| PubChem CID | 107772699 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol |
| SMILES | CCNC1CCC2(CC1SC(C)C(C)O)OCCO2 |
| InChI | InChI=1S/C14H27NO3S/c1-4-15-12-5-6-14(17-7-8-18-14)9-13(12)19-11(3)10(2)16/h10-13,15-16H,4-9H2,1-3H3 |
| InChIKey | XHXCEGSXQAZPGG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol?
The IUPAC name of 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol (CID 107772699) is 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol.
What is the SMILES notation for 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol?
The canonical SMILES for 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol is CCNC1CCC2(CC1SC(C)C(C)O)OCCO2.
What is the InChIKey of 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol?
The InChIKey is XHXCEGSXQAZPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-4-15-12-5-6-14(17-7-8-18-14)9-13(12)19-11(3)10(2)16/h10-13,15-16H,4-9H2,1-3H3.
What are the key properties of 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol?
3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol has a molecular weight of 289.44 g/mol, XLogP of 1.76, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[8-(ethylamino)-1,4-dioxaspiro[4.5]decan-7-yl]sulfanyl]butan-2-ol is sourced from PubChem (CID 107772699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).