C16H22BrNO2S — CID 64632779
7-(3-bromophenyl)sulfanyl-N-ethyl-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 64632779) has the molecular formula C16H22BrNO2S and a molecular weight of 372.33 g/mol. Its IUPAC name is 7-(3-bromophenyl)sulfanyl-N-ethyl-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(3-bromophenyl)sulfanyl-N-ethyl-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 64632779 |
| Molecular Formula | C16H22BrNO2S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 7-(3-bromophenyl)sulfanyl-N-ethyl-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | CCNC1CCC2(CC1Sc1cccc(Br)c1)OCCO2 |
| InChI | InChI=1S/C16H22BrNO2S/c1-2-18-14-6-7-16(19-8-9-20-16)11-15(14)21-13-5-3-4-12(17)10-13/h3-5,10,14-15,18H,2,6-9,11H2,1H3 |
| InChIKey | AHBQNSFLUKXLBM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |