C15H27N3OS — CID 107772924
3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylbutan-2-ol (PubChem CID 107772924) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylbutan-2-ol.
| Compound Name | 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772924 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylbutan-2-ol |
| SMILES | CCCNc1nc(CCC)nc(SC(C)C(C)O)c1C |
| InChI | InChI=1S/C15H27N3OS/c1-6-8-13-17-14(16-9-7-2)10(3)15(18-13)20-12(5)11(4)19/h11-12,19H,6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | OUCPGNFHIVPLBR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |