C15H25N3O2S — CID 80991417
methyl 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylpropanoate (PubChem CID 80991417) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is methyl 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 80991417 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | methyl 3-[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]sulfanylpropanoate |
| SMILES | CCCNc1nc(CCC)nc(SCCC(=O)OC)c1C |
| InChI | InChI=1S/C15H25N3O2S/c1-5-7-12-17-14(16-9-6-2)11(3)15(18-12)21-10-8-13(19)20-4/h5-10H2,1-4H3,(H,16,17,18) |
| InChIKey | HOMGBVVUYAEJET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |