C15H26N4O2 — CID 80986480
methyl 3-[[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 80986480) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is methyl 3-[[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 80986480 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | methyl 3-[[5-methyl-2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | CCCNc1nc(CCC)nc(NCCC(=O)OC)c1C |
| InChI | InChI=1S/C15H26N4O2/c1-5-7-12-18-14(16-9-6-2)11(3)15(19-12)17-10-8-13(20)21-4/h5-10H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | GMJDTZHOOUOFRE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |