C9H14N4O3S — CID 107774544
(2R)-2-acetamido-3-[(1-methyltriazol-4-yl)methylsulfanyl]propanoic acid (PubChem CID 107774544) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(1-methyltriazol-4-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(1-methyltriazol-4-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107774544 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2R)-2-acetamido-3-[(1-methyltriazol-4-yl)methylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCc1cn(C)nn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3S/c1-6(14)10-8(9(15)16)5-17-4-7-3-13(2)12-11-7/h3,8H,4-5H2,1-2H3,(H,10,14)(H,15,16)/t8-/m0/s1 |
| InChIKey | XJVNUHRXKKZVOJ-QMMMGPOBSA-N |
| XLogP | -0.36 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |