C10H17N5O3S — CID 107774522
(2R)-2-acetamido-3-[(1-propyltetrazol-5-yl)methylsulfanyl]propanoic acid (PubChem CID 107774522) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(1-propyltetrazol-5-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(1-propyltetrazol-5-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107774522 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2R)-2-acetamido-3-[(1-propyltetrazol-5-yl)methylsulfanyl]propanoic acid |
| SMILES | CCCn1nnnc1CSC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H17N5O3S/c1-3-4-15-9(12-13-14-15)6-19-5-8(10(17)18)11-7(2)16/h8H,3-6H2,1-2H3,(H,11,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | HPOAYOSVRWSAIL-QMMMGPOBSA-N |
| XLogP | -0.09 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |