C11H21N5O2S — CID 106443345
(2S)-2-amino-3-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106443345) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is (2S)-2-amino-3-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443345 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2S)-2-amino-3-[(1-butyltetrazol-5-yl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CCCCn1nnnc1CSC(C)(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C11H21N5O2S/c1-4-5-6-16-8(13-14-15-16)7-19-11(2,3)9(12)10(17)18/h9H,4-7,12H2,1-3H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | GLOVGTZKNKGQDA-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |