C11H21N5O2 — CID 43631568
2-[(1-butyltetrazol-5-yl)methylamino]pentanoic acid (PubChem CID 43631568) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(1-butyltetrazol-5-yl)methylamino]pentanoic acid.
| Compound Name | 2-[(1-butyltetrazol-5-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 43631568 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-[(1-butyltetrazol-5-yl)methylamino]pentanoic acid |
| SMILES | CCCCn1nnnc1CNC(CCC)C(=O)O |
| InChI | InChI=1S/C11H21N5O2/c1-3-5-7-16-10(13-14-15-16)8-12-9(6-4-2)11(17)18/h9,12H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | ZRWQXJRSQJFVPK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |