C12H23N5O2 — CID 65290086
4-methyl-6-[(1-propyltetrazol-5-yl)methylamino]hexanoic acid (PubChem CID 65290086) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-methyl-6-[(1-propyltetrazol-5-yl)methylamino]hexanoic acid.
| Compound Name | 4-methyl-6-[(1-propyltetrazol-5-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 65290086 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-methyl-6-[(1-propyltetrazol-5-yl)methylamino]hexanoic acid |
| SMILES | CCCn1nnnc1CNCCC(C)CCC(=O)O |
| InChI | InChI=1S/C12H23N5O2/c1-3-8-17-11(14-15-16-17)9-13-7-6-10(2)4-5-12(18)19/h10,13H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | FWLVSJDPGFQADM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|