C14H23NO2S — CID 65287603
6-[(5-ethylthiophen-2-yl)methylamino]-4-methylhexanoic acid (PubChem CID 65287603) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 6-[(5-ethylthiophen-2-yl)methylamino]-4-methylhexanoic acid.
| Compound Name | 6-[(5-ethylthiophen-2-yl)methylamino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 65287603 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-[(5-ethylthiophen-2-yl)methylamino]-4-methylhexanoic acid |
| SMILES | CCc1ccc(CNCCC(C)CCC(=O)O)s1 |
| InChI | InChI=1S/C14H23NO2S/c1-3-12-5-6-13(18-12)10-15-9-8-11(2)4-7-14(16)17/h5-6,11,15H,3-4,7-10H2,1-2H3,(H,16,17) |
| InChIKey | HHUNDHZKSUVSGJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|