C11H19N3O2S — CID 106443279
(2S)-2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]-3-methylbutanoic acid (PubChem CID 106443279) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is (2S)-2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106443279 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]-3-methylbutanoic acid |
| SMILES | CCn1ccnc1CSC(C)(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C11H19N3O2S/c1-4-14-6-5-13-8(14)7-17-11(2,3)9(12)10(15)16/h5-6,9H,4,7,12H2,1-3H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | QPLAQXNUAKCHPD-VIFPVBQESA-N |
| XLogP | 1.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |