C9H15N3O2S — CID 62738079
2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]propanoic acid (PubChem CID 62738079) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 62738079 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-3-[(1-ethylimidazol-2-yl)methylsulfanyl]propanoic acid |
| SMILES | CCn1ccnc1CSCC(N)C(=O)O |
| InChI | InChI=1S/C9H15N3O2S/c1-2-12-4-3-11-8(12)6-15-5-7(10)9(13)14/h3-4,7H,2,5-6,10H2,1H3,(H,13,14) |
| InChIKey | HPAYJBSBGDPGIH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |