C12H20N2O — CID 115783502
1-(1-ethylimidazol-2-yl)-3,4-dimethylpentan-2-one (PubChem CID 115783502) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-3,4-dimethylpentan-2-one.
| Compound Name | 1-(1-ethylimidazol-2-yl)-3,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 115783502 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-3,4-dimethylpentan-2-one |
| SMILES | CCn1ccnc1CC(=O)C(C)C(C)C |
| InChI | InChI=1S/C12H20N2O/c1-5-14-7-6-13-12(14)8-11(15)10(4)9(2)3/h6-7,9-10H,5,8H2,1-4H3 |
| InChIKey | FILPUVMESLUVPS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |