C12H19N3O5S — CID 107774996
(2R)-2-acetamido-3-[(2-ethyl-5-methylpyrazol-3-yl)methylsulfonyl]propanoic acid (PubChem CID 107774996) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2-ethyl-5-methylpyrazol-3-yl)methylsulfonyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(2-ethyl-5-methylpyrazol-3-yl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 107774996 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2R)-2-acetamido-3-[(2-ethyl-5-methylpyrazol-3-yl)methylsulfonyl]propanoic acid |
| SMILES | CCn1nc(C)cc1CS(=O)(=O)C[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C12H19N3O5S/c1-4-15-10(5-8(2)14-15)6-21(19,20)7-11(12(17)18)13-9(3)16/h5,11H,4,6-7H2,1-3H3,(H,13,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | SSSILIXSWMUXAR-NSHDSACASA-N |
| XLogP | -0.28 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |