C16H19NO2 — CID 10777544
(2S,5Z)-3-phenyl-2-propan-2-yl-5-propylidene-2H-1,4-oxazin-6-one (PubChem CID 10777544) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S,5Z)-3-phenyl-2-propan-2-yl-5-propylidene-2H-1,4-oxazin-6-one.
| Compound Name | (2S,5Z)-3-phenyl-2-propan-2-yl-5-propylidene-2H-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 10777544 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S,5Z)-3-phenyl-2-propan-2-yl-5-propylidene-2H-1,4-oxazin-6-one |
| SMILES | CC/C=C1\N=C(c2ccccc2)[C@H](C(C)C)OC1=O |
| InChI | InChI=1S/C16H19NO2/c1-4-8-13-16(18)19-15(11(2)3)14(17-13)12-9-6-5-7-10-12/h5-11,15H,4H2,1-3H3/b13-8-/t15-/m0/s1 |
| InChIKey | WZBGZRXMUUEQOB-ODDCISTRSA-N |
| XLogP | 3.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|