C13H20O4S — CID 107775852
2-ethyl-4-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]but-2-enoic acid (PubChem CID 107775852) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-ethyl-4-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]but-2-enoic acid |
|---|---|
| PubChem CID | 107775852 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-ethyl-4-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]but-2-enoic acid |
| SMILES | CCC(=CCSCC1(CC(=O)OC)CC1)C(=O)O |
| InChI | InChI=1S/C13H20O4S/c1-3-10(12(15)16)4-7-18-9-13(5-6-13)8-11(14)17-2/h4H,3,5-9H2,1-2H3,(H,15,16) |
| InChIKey | WPKDVCCWFDXSTG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|