C12H22O2S — CID 107775972
methyl 2-[1-(pentan-3-ylsulfanylmethyl)cyclopropyl]acetate (PubChem CID 107775972) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is methyl 2-[1-(pentan-3-ylsulfanylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(pentan-3-ylsulfanylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107775972 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | methyl 2-[1-(pentan-3-ylsulfanylmethyl)cyclopropyl]acetate |
| SMILES | CCC(CC)SCC1(CC(=O)OC)CC1 |
| InChI | InChI=1S/C12H22O2S/c1-4-10(5-2)15-9-12(6-7-12)8-11(13)14-3/h10H,4-9H2,1-3H3 |
| InChIKey | ZPYIOUJHHNSKFN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |