C12H20O4S — CID 107775863
3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]-2-methylbutanoic acid (PubChem CID 107775863) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]-2-methylbutanoic acid.
| Compound Name | 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 107775863 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]-2-methylbutanoic acid |
| SMILES | COC(=O)CC1(CSC(C)C(C)C(=O)O)CC1 |
| InChI | InChI=1S/C12H20O4S/c1-8(11(14)15)9(2)17-7-12(4-5-12)6-10(13)16-3/h8-9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | MBUIKHPDZZJNED-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |