C16H19FO3S — CID 107777673
methyl 2-[1-[[1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777673) has the molecular formula C16H19FO3S and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 2-[1-[[1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777673 |
| Molecular Formula | C16H19FO3S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 2-[1-[[1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSC(C)C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H19FO3S/c1-11(15(19)12-3-5-13(17)6-4-12)21-10-16(7-8-16)9-14(18)20-2/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | CGIHJKWEOSCSII-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |