C14H14BrF3O2S — CID 107776858
methyl 2-[1-[[5-bromo-2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776858) has the molecular formula C14H14BrF3O2S and a molecular weight of 383.23 g/mol. Its IUPAC name is methyl 2-[1-[[5-bromo-2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[5-bromo-2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776858 |
| Molecular Formula | C14H14BrF3O2S |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | methyl 2-[1-[[5-bromo-2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cc(Br)ccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H14BrF3O2S/c1-20-12(19)7-13(4-5-13)8-21-11-6-9(15)2-3-10(11)14(16,17)18/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | LFPCLNUPPZUUSU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |