C15H20BrNO2S — CID 107777524
methyl 2-[1-[[4-[(1S)-1-aminoethyl]-2-bromophenyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777524) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is methyl 2-[1-[[4-[(1S)-1-aminoethyl]-2-bromophenyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[4-[(1S)-1-aminoethyl]-2-bromophenyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777524 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | methyl 2-[1-[[4-[(1S)-1-aminoethyl]-2-bromophenyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2ccc([C@H](C)N)cc2Br)CC1 |
| InChI | InChI=1S/C15H20BrNO2S/c1-10(17)11-3-4-13(12(16)7-11)20-9-15(5-6-15)8-14(18)19-2/h3-4,7,10H,5-6,8-9,17H2,1-2H3/t10-/m0/s1 |
| InChIKey | KPSMPKWYIKJVPQ-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |