C14H14BrNO2S — CID 107777093
methyl 2-[1-[(3-bromo-2-cyanophenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777093) has the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. Its IUPAC name is methyl 2-[1-[(3-bromo-2-cyanophenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(3-bromo-2-cyanophenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777093 |
| Molecular Formula | C14H14BrNO2S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | methyl 2-[1-[(3-bromo-2-cyanophenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cccc(Br)c2C#N)CC1 |
| InChI | InChI=1S/C14H14BrNO2S/c1-18-13(17)7-14(5-6-14)9-19-12-4-2-3-11(15)10(12)8-16/h2-4H,5-7,9H2,1H3 |
| InChIKey | IRHCDAXOYTYNJC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |