C14H15FO3S — CID 114066181
methyl 2-[1-[(3-fluoro-2-formylphenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 114066181) has the molecular formula C14H15FO3S and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 2-[1-[(3-fluoro-2-formylphenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(3-fluoro-2-formylphenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 114066181 |
| Molecular Formula | C14H15FO3S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl 2-[1-[(3-fluoro-2-formylphenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cccc(F)c2C=O)CC1 |
| InChI | InChI=1S/C14H15FO3S/c1-18-13(17)7-14(5-6-14)9-19-12-4-2-3-11(15)10(12)8-16/h2-4,8H,5-7,9H2,1H3 |
| InChIKey | UNFGHZUBSCVNTP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|