C16H22O4S — CID 107778450
methyl 2-[1-[[2-[(1R)-1-hydroxyethyl]-3-methoxyphenyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107778450) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is methyl 2-[1-[[2-[(1R)-1-hydroxyethyl]-3-methoxyphenyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[2-[(1R)-1-hydroxyethyl]-3-methoxyphenyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778450 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl 2-[1-[[2-[(1R)-1-hydroxyethyl]-3-methoxyphenyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cccc(OC)c2[C@@H](C)O)CC1 |
| InChI | InChI=1S/C16H22O4S/c1-11(17)15-12(19-2)5-4-6-13(15)21-10-16(7-8-16)9-14(18)20-3/h4-6,11,17H,7-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | DJMWAXYFBBFKSV-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |