C14H15F3O2S — CID 107777110
methyl 2-[1-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777110) has the molecular formula C14H15F3O2S and a molecular weight of 304.33 g/mol. Its IUPAC name is methyl 2-[1-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777110 |
| Molecular Formula | C14H15F3O2S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 2-[1-[[2-(trifluoromethyl)phenyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H15F3O2S/c1-19-12(18)8-13(6-7-13)9-20-11-5-3-2-4-10(11)14(15,16)17/h2-5H,6-9H2,1H3 |
| InChIKey | JOECAXVNIYAQQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |