C16H19FO3S — CID 107777467
methyl 2-[1-[(2-acetyl-4-fluoro-5-methylphenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777467) has the molecular formula C16H19FO3S and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 2-[1-[(2-acetyl-4-fluoro-5-methylphenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(2-acetyl-4-fluoro-5-methylphenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777467 |
| Molecular Formula | C16H19FO3S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 2-[1-[(2-acetyl-4-fluoro-5-methylphenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cc(C)c(F)cc2C(C)=O)CC1 |
| InChI | InChI=1S/C16H19FO3S/c1-10-6-14(12(11(2)18)7-13(10)17)21-9-16(4-5-16)8-15(19)20-3/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | SZJRIGHEIBLNSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |