C13H13BrFNO4S — CID 107776916
methyl 2-[1-[(4-bromo-5-fluoro-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776916) has the molecular formula C13H13BrFNO4S and a molecular weight of 378.22 g/mol. Its IUPAC name is methyl 2-[1-[(4-bromo-5-fluoro-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(4-bromo-5-fluoro-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776916 |
| Molecular Formula | C13H13BrFNO4S |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | methyl 2-[1-[(4-bromo-5-fluoro-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cc(F)c(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H13BrFNO4S/c1-20-12(17)6-13(2-3-13)7-21-11-5-9(15)8(14)4-10(11)16(18)19/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | HUKDCJSJPDLOIS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|