C13H14FNO4S — CID 107776954
methyl 2-[1-[(3-fluoro-5-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776954) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is methyl 2-[1-[(3-fluoro-5-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(3-fluoro-5-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776954 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | methyl 2-[1-[(3-fluoro-5-nitrophenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cc(F)cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H14FNO4S/c1-19-12(16)7-13(2-3-13)8-20-11-5-9(14)4-10(6-11)15(17)18/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | VZHBZISZOISPKF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|