C15H17ClO3S — CID 107777463
methyl 2-[1-[(4-acetyl-3-chlorophenyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777463) has the molecular formula C15H17ClO3S and a molecular weight of 312.82 g/mol. Its IUPAC name is methyl 2-[1-[(4-acetyl-3-chlorophenyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(4-acetyl-3-chlorophenyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107777463 |
| Molecular Formula | C15H17ClO3S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | methyl 2-[1-[(4-acetyl-3-chlorophenyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2ccc(C(C)=O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H17ClO3S/c1-10(17)12-4-3-11(7-13(12)16)20-9-15(5-6-15)8-14(18)19-2/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | BDHZJAZURNQCOG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |