C16H27NO3S — CID 107775985
methyl 2-[1-[[2-(cycloheptylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107775985) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is methyl 2-[1-[[2-(cycloheptylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[2-(cycloheptylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107775985 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl 2-[1-[[2-(cycloheptylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCC(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H27NO3S/c1-20-15(19)10-16(8-9-16)12-21-11-14(18)17-13-6-4-2-3-5-7-13/h13H,2-12H2,1H3,(H,17,18) |
| InChIKey | RMKUMESQRJEKKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |