C15H26O3S — CID 114000240
methyl 2-[1-[(3-cyclopentyl-2-hydroxypropyl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 114000240) has the molecular formula C15H26O3S and a molecular weight of 286.44 g/mol. Its IUPAC name is methyl 2-[1-[(3-cyclopentyl-2-hydroxypropyl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(3-cyclopentyl-2-hydroxypropyl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 114000240 |
| Molecular Formula | C15H26O3S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl 2-[1-[(3-cyclopentyl-2-hydroxypropyl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCC(O)CC2CCCC2)CC1 |
| InChI | InChI=1S/C15H26O3S/c1-18-14(17)9-15(6-7-15)11-19-10-13(16)8-12-4-2-3-5-12/h12-13,16H,2-11H2,1H3 |
| InChIKey | IHPQVIWHZJKKEJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |