C11H17F3O2S — CID 107776256
methyl 2-[1-(4,4,4-trifluorobutylsulfanylmethyl)cyclopropyl]acetate (PubChem CID 107776256) has the molecular formula C11H17F3O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is methyl 2-[1-(4,4,4-trifluorobutylsulfanylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(4,4,4-trifluorobutylsulfanylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776256 |
| Molecular Formula | C11H17F3O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl 2-[1-(4,4,4-trifluorobutylsulfanylmethyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3O2S/c1-16-9(15)7-10(4-5-10)8-17-6-2-3-11(12,13)14/h2-8H2,1H3 |
| InChIKey | KYAOMSWLBHRSAR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|