C11H19F3O2S — CID 87340505
methyl 2-(5,5,5-trifluoropentylsulfanyl)pentanoate (PubChem CID 87340505) has the molecular formula C11H19F3O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 2-(5,5,5-trifluoropentylsulfanyl)pentanoate.
| Compound Name | methyl 2-(5,5,5-trifluoropentylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340505 |
| Molecular Formula | C11H19F3O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | methyl 2-(5,5,5-trifluoropentylsulfanyl)pentanoate |
| SMILES | CCCC(SCCCCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C11H19F3O2S/c1-3-6-9(10(15)16-2)17-8-5-4-7-11(12,13)14/h9H,3-8H2,1-2H3 |
| InChIKey | NZGCUYQFXUOPEO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|