C14H26F2O2S — CID 87339665
ethyl 2-(4,4-difluoroheptylsulfanyl)pentanoate (PubChem CID 87339665) has the molecular formula C14H26F2O2S and a molecular weight of 296.42 g/mol. Its IUPAC name is ethyl 2-(4,4-difluoroheptylsulfanyl)pentanoate.
| Compound Name | ethyl 2-(4,4-difluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87339665 |
| Molecular Formula | C14H26F2O2S |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl 2-(4,4-difluoroheptylsulfanyl)pentanoate |
| SMILES | CCCC(SCCCC(F)(F)CCC)C(=O)OCC |
| InChI | InChI=1S/C14H26F2O2S/c1-4-8-12(13(17)18-6-3)19-11-7-10-14(15,16)9-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | POCHZZBWNWHWAY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|