C12H21NO5S2 — CID 107776322
methyl 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776322) has the molecular formula C12H21NO5S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is methyl 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776322 |
| Molecular Formula | C12H21NO5S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | methyl 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCCS(=O)(=O)CCC(N)=O)CC1 |
| InChI | InChI=1S/C12H21NO5S2/c1-18-11(15)8-12(3-4-12)9-19-5-7-20(16,17)6-2-10(13)14/h2-9H2,1H3,(H2,13,14) |
| InChIKey | DEULZSHSQMKPHH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|