C10H15F3O5S — CID 107776585
methyl 2-[1-[2-(trifluoromethoxy)ethylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776585) has the molecular formula C10H15F3O5S and a molecular weight of 304.29 g/mol. Its IUPAC name is methyl 2-[1-[2-(trifluoromethoxy)ethylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(trifluoromethoxy)ethylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776585 |
| Molecular Formula | C10H15F3O5S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 2-[1-[2-(trifluoromethoxy)ethylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)CCOC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3O5S/c1-17-8(14)6-9(2-3-9)7-19(15,16)5-4-18-10(11,12)13/h2-7H2,1H3 |
| InChIKey | YRGFLMGVBNNJPK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |