C10H15F3O5S — CID 65441338
2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid (PubChem CID 65441338) has the molecular formula C10H15F3O5S and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65441338 |
| Molecular Formula | C10H15F3O5S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3O5S/c11-10(12,13)6-18-3-4-19(16,17)7-9(1-2-9)5-8(14)15/h1-7H2,(H,14,15) |
| InChIKey | QSJNMVLRMATSPD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|